C23H24N4O5S — CID 137065610
ethyl (4S)-4-[2-[2-[2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 137065610) has the molecular formula C23H24N4O5S and a molecular weight of 468.54 g/mol. Its IUPAC name is ethyl (4S)-4-[2-[2-[2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-4-[2-[2-[2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137065610 |
| Molecular Formula | C23H24N4O5S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | ethyl (4S)-4-[2-[2-[2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=S)N[C@H]1c1ccccc1OCC(=O)NN=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C23H24N4O5S/c1-3-31-22(30)20-14(2)25-23(33)26-21(20)17-6-4-5-7-18(17)32-13-19(29)27-24-12-15-8-10-16(28)11-9-15/h4-12,21,28H,3,13H2,1-2H3,(H,27,29)(H2,25,26,33)/t21-/m0/s1 |
| InChIKey | DMGDUKZPPWIIIS-NRFANRHFSA-N |
| XLogP | 2.28 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|