C23H23ClN4O5S — CID 137065656
ethyl (4S)-4-[2-[2-[2-[(5-chloro-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 137065656) has the molecular formula C23H23ClN4O5S and a molecular weight of 502.98 g/mol. Its IUPAC name is ethyl (4S)-4-[2-[2-[2-[(5-chloro-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-4-[2-[2-[2-[(5-chloro-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137065656 |
| Molecular Formula | C23H23ClN4O5S |
| Molecular Weight | 502.98 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | ethyl (4S)-4-[2-[2-[2-[(5-chloro-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=S)N[C@H]1c1ccccc1OCC(=O)NN=Cc1cc(Cl)ccc1O |
| InChI | InChI=1S/C23H23ClN4O5S/c1-3-32-22(31)20-13(2)26-23(34)27-21(20)16-6-4-5-7-18(16)33-12-19(30)28-25-11-14-10-15(24)8-9-17(14)29/h4-11,21,29H,3,12H2,1-2H3,(H,28,30)(H2,26,27,34)/t21-/m0/s1 |
| InChIKey | HGNYQHNJPSEIGX-NRFANRHFSA-N |
| XLogP | 2.93 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.98 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|