C24H25BrN4O6S — CID 137065607
ethyl (4S)-4-[2-[2-[2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 137065607) has the molecular formula C24H25BrN4O6S and a molecular weight of 577.46 g/mol. Its IUPAC name is ethyl (4S)-4-[2-[2-[2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-4-[2-[2-[2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137065607 |
| Molecular Formula | C24H25BrN4O6S |
| Molecular Weight | 577.46 g/mol |
| Exact Mass | 576.07 |
| IUPAC Name | ethyl (4S)-4-[2-[2-[2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=S)N[C@H]1c1ccccc1OCC(=O)NN=Cc1cc(Br)c(O)c(OC)c1 |
| InChI | InChI=1S/C24H25BrN4O6S/c1-4-34-23(32)20-13(2)27-24(36)28-21(20)15-7-5-6-8-17(15)35-12-19(30)29-26-11-14-9-16(25)22(31)18(10-14)33-3/h5-11,21,31H,4,12H2,1-3H3,(H,29,30)(H2,27,28,36)/t21-/m0/s1 |
| InChIKey | DEYKYOUVTIXLRS-NRFANRHFSA-N |
| XLogP | 3.05 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|