C24H24Br2N4O6S — CID 137065700
ethyl (4S)-4-[2-[2-[2-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 137065700) has the molecular formula C24H24Br2N4O6S and a molecular weight of 656.35 g/mol. Its IUPAC name is ethyl (4S)-4-[2-[2-[2-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-4-[2-[2-[2-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137065700 |
| Molecular Formula | C24H24Br2N4O6S |
| Molecular Weight | 656.35 g/mol |
| Exact Mass | 653.98 |
| IUPAC Name | ethyl (4S)-4-[2-[2-[2-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=S)N[C@H]1c1ccccc1OCC(=O)NN=Cc1cc(OC)c(O)c(Br)c1Br |
| InChI | InChI=1S/C24H24Br2N4O6S/c1-4-35-23(33)18-12(2)28-24(37)29-21(18)14-7-5-6-8-15(14)36-11-17(31)30-27-10-13-9-16(34-3)22(32)20(26)19(13)25/h5-10,21,32H,4,11H2,1-3H3,(H,30,31)(H2,28,29,37)/t21-/m0/s1 |
| InChIKey | INWUODINHDWIBK-NRFANRHFSA-N |
| XLogP | 3.81 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|