C23H22BrN5O7S — CID 137065683
ethyl (4R)-4-[2-[2-[2-[(3-bromo-4-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 137065683) has the molecular formula C23H22BrN5O7S and a molecular weight of 592.43 g/mol. Its IUPAC name is ethyl (4R)-4-[2-[2-[2-[(3-bromo-4-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4R)-4-[2-[2-[2-[(3-bromo-4-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137065683 |
| Molecular Formula | C23H22BrN5O7S |
| Molecular Weight | 592.43 g/mol |
| Exact Mass | 591.04 |
| IUPAC Name | ethyl (4R)-4-[2-[2-[2-[(3-bromo-4-hydroxy-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=S)N[C@@H]1c1ccccc1OCC(=O)NN=Cc1cc(Br)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H22BrN5O7S/c1-3-35-22(32)19-12(2)26-23(37)27-20(19)14-6-4-5-7-17(14)36-11-18(30)28-25-10-13-8-15(24)21(31)16(9-13)29(33)34/h4-10,20,31H,3,11H2,1-2H3,(H,28,30)(H2,26,27,37)/t20-/m1/s1 |
| InChIKey | HTJSJISYNXHHDK-HXUWFJFHSA-N |
| XLogP | 2.95 |
| TPSA | 164.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|