C27H25N5O8S — CID 137138889
ethyl (4R)-4-[2-[2-[2-[[5-(2-hydroxy-5-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 137138889) has the molecular formula C27H25N5O8S and a molecular weight of 579.59 g/mol. Its IUPAC name is ethyl (4R)-4-[2-[2-[2-[[5-(2-hydroxy-5-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4R)-4-[2-[2-[2-[[5-(2-hydroxy-5-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137138889 |
| Molecular Formula | C27H25N5O8S |
| Molecular Weight | 579.59 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | ethyl (4R)-4-[2-[2-[2-[[5-(2-hydroxy-5-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=S)N[C@@H]1c1ccccc1OCC(=O)NN=Cc1ccc(-c2cc([N+](=O)[O-])ccc2O)o1 |
| InChI | InChI=1S/C27H25N5O8S/c1-3-38-26(35)24-15(2)29-27(41)30-25(24)18-6-4-5-7-21(18)39-14-23(34)31-28-13-17-9-11-22(40-17)19-12-16(32(36)37)8-10-20(19)33/h4-13,25,33H,3,14H2,1-2H3,(H,31,34)(H2,29,30,41)/t25-/m1/s1 |
| InChIKey | LAHHVAKCWPBYGR-RUZDIDTESA-N |
| XLogP | 3.45 |
| TPSA | 177.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|