C26H29N5O6 — CID 137079756
methyl (4R)-4-[3-ethoxy-4-[(2S)-2-hydroxy-2-[(2Z)-2-(1H-indol-3-ylmethylidene)hydrazinyl]ethoxy]phenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 137079756) has the molecular formula C26H29N5O6 and a molecular weight of 507.55 g/mol. Its IUPAC name is methyl (4R)-4-[3-ethoxy-4-[(2S)-2-hydroxy-2-[(2Z)-2-(1H-indol-3-ylmethylidene)hydrazinyl]ethoxy]phenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl (4R)-4-[3-ethoxy-4-[(2S)-2-hydroxy-2-[(2Z)-2-(1H-indol-3-ylmethylidene)hydrazinyl]ethoxy]phenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137079756 |
| Molecular Formula | C26H29N5O6 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | methyl (4R)-4-[3-ethoxy-4-[(2S)-2-hydroxy-2-[(2Z)-2-(1H-indol-3-ylmethylidene)hydrazinyl]ethoxy]phenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOc1cc([C@H]2NC(=O)NC(C)=C2C(=O)OC)ccc1OC[C@H](O)N/N=C\c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C26H29N5O6/c1-4-36-21-11-16(24-23(25(33)35-3)15(2)29-26(34)30-24)9-10-20(21)37-14-22(32)31-28-13-17-12-27-19-8-6-5-7-18(17)19/h5-13,22,24,27,31-32H,4,14H2,1-3H3,(H2,29,30,34)/b28-13-/t22-,24+/m0/s1 |
| InChIKey | VIDICEFHDXQWSS-URFBPECUSA-N |
| XLogP | 2.69 |
| TPSA | 146.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|