C25H29BrN4O8 — CID 137079712
methyl (4R)-4-[4-[(2S)-2-[(2Z)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-hydroxyethoxy]-3-ethoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 137079712) has the molecular formula C25H29BrN4O8 and a molecular weight of 593.43 g/mol. Its IUPAC name is methyl (4R)-4-[4-[(2S)-2-[(2Z)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-hydroxyethoxy]-3-ethoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl (4R)-4-[4-[(2S)-2-[(2Z)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-hydroxyethoxy]-3-ethoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137079712 |
| Molecular Formula | C25H29BrN4O8 |
| Molecular Weight | 593.43 g/mol |
| Exact Mass | 592.12 |
| IUPAC Name | methyl (4R)-4-[4-[(2S)-2-[(2Z)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-hydroxyethoxy]-3-ethoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOc1cc([C@H]2NC(=O)NC(C)=C2C(=O)OC)ccc1OC[C@H](O)N/N=C\c1cc(Br)cc(OC)c1O |
| InChI | InChI=1S/C25H29BrN4O8/c1-5-37-18-9-14(22-21(24(33)36-4)13(2)28-25(34)29-22)6-7-17(18)38-12-20(31)30-27-11-15-8-16(26)10-19(35-3)23(15)32/h6-11,20,22,30-32H,5,12H2,1-4H3,(H2,28,29,34)/b27-11-/t20-,22+/m0/s1 |
| InChIKey | SKVODJIPBBHPCK-FZDRLKPYSA-N |
| XLogP | 2.68 |
| TPSA | 159.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|