C22H23N6O7P — CID 137139926
[(2R,3S,5R)-5-[2-[3-(4-aminophenyl)anilino]-6-oxo-1H-purin-9-yl]-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 137139926) has the molecular formula C22H23N6O7P and a molecular weight of 514.44 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[2-[3-(4-aminophenyl)anilino]-6-oxo-1H-purin-9-yl]-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-[2-[3-(4-aminophenyl)anilino]-6-oxo-1H-purin-9-yl]-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 137139926 |
| Molecular Formula | C22H23N6O7P |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | [(2R,3S,5R)-5-[2-[3-(4-aminophenyl)anilino]-6-oxo-1H-purin-9-yl]-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | Nc1ccc(-c2cccc(Nc3nc4c(ncn4[C@H]4C[C@H](OP(=O)(O)O)[C@@H](CO)O4)c(=O)[nH]3)c2)cc1 |
| InChI | InChI=1S/C22H23N6O7P/c23-14-6-4-12(5-7-14)13-2-1-3-15(8-13)25-22-26-20-19(21(30)27-22)24-11-28(20)18-9-16(17(10-29)34-18)35-36(31,32)33/h1-8,11,16-18,29H,9-10,23H2,(H2,31,32,33)(H2,25,26,27,30)/t16-,17+,18+/m0/s1 |
| InChIKey | WFYCYUOAABJOOD-RCCFBDPRSA-N |
| XLogP | 1.87 |
| TPSA | 197.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|