C5H6N6S — CID 137145604
[5-(1H-pyrazol-4-yl)-1,2,4-thiadiazol-3-yl]hydrazine (PubChem CID 137145604) has the molecular formula C5H6N6S and a molecular weight of 182.21 g/mol. Its IUPAC name is [5-(1H-pyrazol-4-yl)-1,2,4-thiadiazol-3-yl]hydrazine.
| Compound Name | [5-(1H-pyrazol-4-yl)-1,2,4-thiadiazol-3-yl]hydrazine |
|---|---|
| PubChem CID | 137145604 |
| Molecular Formula | C5H6N6S |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | [5-(1H-pyrazol-4-yl)-1,2,4-thiadiazol-3-yl]hydrazine |
| SMILES | NNc1nsc(-c2cn[nH]c2)n1 |
| InChI | InChI=1S/C5H6N6S/c6-10-5-9-4(12-11-5)3-1-7-8-2-3/h1-2H,6H2,(H,7,8)(H,10,11) |
| InChIKey | NWQMBJZGYOIWGM-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|