C20H28N2O5 — CID 137149686
2-[(2-cyclobutyl-4-methoxyphenyl)methylimino]-6-(hydroxymethyl)-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazole-4,5-diol (PubChem CID 137149686) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is 2-[(2-cyclobutyl-4-methoxyphenyl)methylimino]-6-(hydroxymethyl)-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazole-4,5-diol.
| Compound Name | 2-[(2-cyclobutyl-4-methoxyphenyl)methylimino]-6-(hydroxymethyl)-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazole-4,5-diol |
|---|---|
| PubChem CID | 137149686 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 2-[(2-cyclobutyl-4-methoxyphenyl)methylimino]-6-(hydroxymethyl)-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazole-4,5-diol |
| SMILES | COc1ccc(C/N=C2/NC3C(CC(CO)C(O)C3O)O2)c(C2CCC2)c1 |
| InChI | InChI=1S/C20H28N2O5/c1-26-14-6-5-12(15(8-14)11-3-2-4-11)9-21-20-22-17-16(27-20)7-13(10-23)18(24)19(17)25/h5-6,8,11,13,16-19,23-25H,2-4,7,9-10H2,1H3,(H,21,22) |
| InChIKey | HDWUCQZWWWQJTE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|