C21H25N5O3 — CID 137152574
2-[[3-[(2-morpholin-4-ylethylamino)methyl]phenoxy]methyl]-3H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 137152574) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[[3-[(2-morpholin-4-ylethylamino)methyl]phenoxy]methyl]-3H-pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-[[3-[(2-morpholin-4-ylethylamino)methyl]phenoxy]methyl]-3H-pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137152574 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-[[3-[(2-morpholin-4-ylethylamino)methyl]phenoxy]methyl]-3H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(COc2cccc(CNCCN3CCOCC3)c2)nc2cnccc12 |
| InChI | InChI=1S/C21H25N5O3/c27-21-18-4-5-22-14-19(18)24-20(25-21)15-29-17-3-1-2-16(12-17)13-23-6-7-26-8-10-28-11-9-26/h1-5,12,14,23H,6-11,13,15H2,(H,24,25,27) |
| InChIKey | DZTPUKGZYQJXBS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|