C12H12N2O2 — CID 137170172
2-diazo-1-(6-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)ethanone (PubChem CID 137170172) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-diazo-1-(6-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)ethanone.
| Compound Name | 2-diazo-1-(6-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)ethanone |
|---|---|
| PubChem CID | 137170172 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-diazo-1-(6-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)ethanone |
| SMILES | [N-]=[N+]=CC(=O)C1CCc2cc(O)ccc2C1 |
| InChI | InChI=1S/C12H12N2O2/c13-14-7-12(16)10-2-1-9-6-11(15)4-3-8(9)5-10/h3-4,6-7,10,15H,1-2,5H2 |
| InChIKey | AJAZPOUGWFDSBC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|