C11H11N3O2S — CID 137175089
3-(2-phenylethylsulfanyl)-1,4-dihydro-1,2,4-triazine-5,6-dione (PubChem CID 137175089) has the molecular formula C11H11N3O2S and a molecular weight of 249.30 g/mol. Its IUPAC name is 3-(2-phenylethylsulfanyl)-1,4-dihydro-1,2,4-triazine-5,6-dione.
| Compound Name | 3-(2-phenylethylsulfanyl)-1,4-dihydro-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 137175089 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 3-(2-phenylethylsulfanyl)-1,4-dihydro-1,2,4-triazine-5,6-dione |
| SMILES | O=c1[nH]nc(SCCc2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C11H11N3O2S/c15-9-10(16)13-14-11(12-9)17-7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,13,16)(H,12,14,15) |
| InChIKey | XWUICAWMJWOEJL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|