C16H16F3NO2 — CID 137176089
(2E)-5,5-dimethyl-3-phenylimino-2-(2,2,2-trifluoro-1-hydroxyethylidene)cyclohexan-1-one (PubChem CID 137176089) has the molecular formula C16H16F3NO2 and a molecular weight of 311.30 g/mol. Its IUPAC name is (2E)-5,5-dimethyl-3-phenylimino-2-(2,2,2-trifluoro-1-hydroxyethylidene)cyclohexan-1-one.
| Compound Name | (2E)-5,5-dimethyl-3-phenylimino-2-(2,2,2-trifluoro-1-hydroxyethylidene)cyclohexan-1-one |
|---|---|
| PubChem CID | 137176089 |
| Molecular Formula | C16H16F3NO2 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (2E)-5,5-dimethyl-3-phenylimino-2-(2,2,2-trifluoro-1-hydroxyethylidene)cyclohexan-1-one |
| SMILES | CC1(C)CC(=O)C(=C(/O)C(F)(F)F)/C(=N/c2ccccc2)C1 |
| InChI | InChI=1S/C16H16F3NO2/c1-15(2)8-11(20-10-6-4-3-5-7-10)13(12(21)9-15)14(22)16(17,18)19/h3-7,22H,8-9H2,1-2H3/b14-13+,20-11+ |
| InChIKey | YUTSHNNBOGBLHX-PTGGQRNNSA-N |
| XLogP | 4.52 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|