C18H15F8NO2 — CID 137176132
(2E)-3-(4-fluorophenyl)imino-2-(2,2,3,3,4,4,4-heptafluoro-1-hydroxybutylidene)-5,5-dimethylcyclohexan-1-one (PubChem CID 137176132) has the molecular formula C18H15F8NO2 and a molecular weight of 429.31 g/mol. Its IUPAC name is (2E)-3-(4-fluorophenyl)imino-2-(2,2,3,3,4,4,4-heptafluoro-1-hydroxybutylidene)-5,5-dimethylcyclohexan-1-one.
| Compound Name | (2E)-3-(4-fluorophenyl)imino-2-(2,2,3,3,4,4,4-heptafluoro-1-hydroxybutylidene)-5,5-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 137176132 |
| Molecular Formula | C18H15F8NO2 |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | (2E)-3-(4-fluorophenyl)imino-2-(2,2,3,3,4,4,4-heptafluoro-1-hydroxybutylidene)-5,5-dimethylcyclohexan-1-one |
| SMILES | CC1(C)CC(=O)C(=C(/O)C(F)(F)C(F)(F)C(F)(F)F)/C(=N/c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H15F8NO2/c1-15(2)7-11(27-10-5-3-9(19)4-6-10)13(12(28)8-15)14(29)16(20,21)17(22,23)18(24,25)26/h3-6,29H,7-8H2,1-2H3/b14-13+,27-11+ |
| InChIKey | RHKALWKDEHYIEC-CTOBIQPBSA-N |
| XLogP | 5.93 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|