About 5,8-dihydroxy-2,3-diiminonaphthalene-1,4-dione
5,8-dihydroxy-2,3-diiminonaphthalene-1,4-dione (PubChem CID 137177307) has the molecular formula C10H6N2O4
and a molecular weight of 218.17 g/mol. Its IUPAC name is 5,8-dihydroxy-2,3-diiminonaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 5,8-dihydroxy-2,3-diiminonaphthalene-1,4-dione |
| PubChem CID | 137177307 |
| Molecular Formula | C10H6N2O4 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 5,8-dihydroxy-2,3-diiminonaphthalene-1,4-dione |
| SMILES | [H]/N=c1\c(=O)c2c(O)ccc(O)c2c(=O)\c1=N\[H] |
| InChI | InChI=1S/C10H6N2O4/c11-7-8(12)10(16)6-4(14)2-1-3(13)5(6)9(7)15/h1-2,11-14H/b11-7-,12-8+ |
| InChIKey | LCRWAMKYRDFZLJ-NTLHZVPKSA-N |
| XLogP | -1.19 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 5,8-dihydroxy-2,3-diiminonaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dihydroxy-2,3-diiminonaphthalene-1,4-dione?
The IUPAC name of 5,8-dihydroxy-2,3-diiminonaphthalene-1,4-dione (CID 137177307) is 5,8-dihydroxy-2,3-diiminonaphthalene-1,4-dione.
What is the SMILES notation for 5,8-dihydroxy-2,3-diiminonaphthalene-1,4-dione?
The canonical SMILES for 5,8-dihydroxy-2,3-diiminonaphthalene-1,4-dione is [H]/N=c1\c(=O)c2c(O)ccc(O)c2c(=O)\c1=N\[H].
What is the InChIKey of 5,8-dihydroxy-2,3-diiminonaphthalene-1,4-dione?
The InChIKey is LCRWAMKYRDFZLJ-NTLHZVPKSA-N. The full InChI is InChI=1S/C10H6N2O4/c11-7-8(12)10(16)6-4(14)2-1-3(13)5(6)9(7)15/h1-2,11-14H/b11-7-,12-8+.
What are the key properties of 5,8-dihydroxy-2,3-diiminonaphthalene-1,4-dione?
5,8-dihydroxy-2,3-diiminonaphthalene-1,4-dione has a molecular weight of 218.17 g/mol, XLogP of -1.19, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dihydroxy-2,3-diiminonaphthalene-1,4-dione is sourced from PubChem (CID 137177307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).