C9H7NOS2 — CID 137182504
2-(1,4,2-dithiazin-3-yl)phenol (PubChem CID 137182504) has the molecular formula C9H7NOS2 and a molecular weight of 209.30 g/mol. Its IUPAC name is 2-(1,4,2-dithiazin-3-yl)phenol.
| Compound Name | 2-(1,4,2-dithiazin-3-yl)phenol |
|---|---|
| PubChem CID | 137182504 |
| Molecular Formula | C9H7NOS2 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.00 |
| IUPAC Name | 2-(1,4,2-dithiazin-3-yl)phenol |
| SMILES | Oc1ccccc1C1=NSC=CS1 |
| InChI | InChI=1S/C9H7NOS2/c11-8-4-2-1-3-7(8)9-10-13-6-5-12-9/h1-6,11H |
| InChIKey | IVPKLRDTWNAELB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|