C9H7NO2S — CID 135587730
2-(2-methylidene-1,3,4-oxathiazol-5-yl)phenol (PubChem CID 135587730) has the molecular formula C9H7NO2S and a molecular weight of 193.23 g/mol. Its IUPAC name is 2-(2-methylidene-1,3,4-oxathiazol-5-yl)phenol.
| Compound Name | 2-(2-methylidene-1,3,4-oxathiazol-5-yl)phenol |
|---|---|
| PubChem CID | 135587730 |
| Molecular Formula | C9H7NO2S |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | 2-(2-methylidene-1,3,4-oxathiazol-5-yl)phenol |
| SMILES | C=C1OC(c2ccccc2O)=NS1 |
| InChI | InChI=1S/C9H7NO2S/c1-6-12-9(10-13-6)7-4-2-3-5-8(7)11/h2-5,11H,1H2 |
| InChIKey | RPHIWJBUFUMZJM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|