C9H12N4O3 — CID 137182788
5-diazenyl-1-ethyl-2-hydroxy-4-methyl-6-oxopyridine-3-carboxamide (PubChem CID 137182788) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 5-diazenyl-1-ethyl-2-hydroxy-4-methyl-6-oxopyridine-3-carboxamide.
| Compound Name | 5-diazenyl-1-ethyl-2-hydroxy-4-methyl-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 137182788 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 5-diazenyl-1-ethyl-2-hydroxy-4-methyl-6-oxopyridine-3-carboxamide |
| SMILES | [H]/N=N/c1c(C)c(C(N)=O)c(O)n(CC)c1=O |
| InChI | InChI=1S/C9H12N4O3/c1-3-13-8(15)5(7(10)14)4(2)6(12-11)9(13)16/h11,15H,3H2,1-2H3,(H2,10,14)/b12-11+ |
| InChIKey | MTKHNBFJKLZTGU-VAWYXSNFSA-N |
| XLogP | 0.64 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|