C24H17N3S — CID 137187475
2,4,5-triphenyl-6H-imidazo[1,5-b]pyridazine-7-thione (PubChem CID 137187475) has the molecular formula C24H17N3S and a molecular weight of 379.49 g/mol. Its IUPAC name is 2,4,5-triphenyl-6H-imidazo[1,5-b]pyridazine-7-thione.
| Compound Name | 2,4,5-triphenyl-6H-imidazo[1,5-b]pyridazine-7-thione |
|---|---|
| PubChem CID | 137187475 |
| Molecular Formula | C24H17N3S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 2,4,5-triphenyl-6H-imidazo[1,5-b]pyridazine-7-thione |
| SMILES | S=c1[nH]c(-c2ccccc2)c2c(-c3ccccc3)cc(-c3ccccc3)nn12 |
| InChI | InChI=1S/C24H17N3S/c28-24-25-22(19-14-8-3-9-15-19)23-20(17-10-4-1-5-11-17)16-21(26-27(23)24)18-12-6-2-7-13-18/h1-16H,(H,25,28) |
| InChIKey | DRPBZMBJRUIEKT-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|