C45H31N3 — CID 137191416
4,5,24,24-tetraphenyl-21,22,23-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene (PubChem CID 137191416) has the molecular formula C45H31N3 and a molecular weight of 613.76 g/mol. Its IUPAC name is 4,5,24,24-tetraphenyl-21,22,23-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene.
| Compound Name | 4,5,24,24-tetraphenyl-21,22,23-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene |
|---|---|
| PubChem CID | 137191416 |
| Molecular Formula | C45H31N3 |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | 4,5,24,24-tetraphenyl-21,22,23-triazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11(23),12,14,16,18(21),19-undecaene |
| SMILES | C1=C/C2=C/C3=C(c4ccccc4)C(c4ccccc4)=C(/C=C4/C=CC(=N4)/C=c4/cc/c([nH]4)=C/C1=N2)C3(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C45H31N3/c1-5-13-31(14-6-1)43-41-29-39-25-23-37(47-39)27-35-21-22-36(46-35)28-38-24-26-40(48-38)30-42(44(43)32-15-7-2-8-16-32)45(41,33-17-9-3-10-18-33)34-19-11-4-12-20-34/h1-30,46H/b35-27-,36-28-,37-27-,38-28-,39-29-,40-30-,41-29-,42-30- |
| InChIKey | DZUQUANKOFILAW-KOYGOVHCSA-N |
| XLogP | 8.29 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |