C18H12N4NiO2 — CID 137196046
(E)-2,3-bis[(2-hydroxyphenyl)methylideneamino]but-2-enedinitrile;nickel (PubChem CID 137196046) has the molecular formula C18H12N4NiO2 and a molecular weight of 375.01 g/mol. Its IUPAC name is (E)-2,3-bis[(2-hydroxyphenyl)methylideneamino]but-2-enedinitrile;nickel.
| Compound Name | (E)-2,3-bis[(2-hydroxyphenyl)methylideneamino]but-2-enedinitrile;nickel |
|---|---|
| PubChem CID | 137196046 |
| Molecular Formula | C18H12N4NiO2 |
| Molecular Weight | 375.01 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | (E)-2,3-bis[(2-hydroxyphenyl)methylideneamino]but-2-enedinitrile;nickel |
| SMILES | N#CC(/N=C/c1ccccc1O)=C(C#N)\N=C\c1ccccc1O.[Ni] |
| InChI | InChI=1S/C18H12N4O2.Ni/c19-9-15(21-11-13-5-1-3-7-17(13)23)16(10-20)22-12-14-6-2-4-8-18(14)24;/h1-8,11-12,23-24H;/b16-15+,21-11+,22-12+; |
| InChIKey | ZKPYUSRFPPDIFO-MFNAOCHNSA-N |
| XLogP | 2.89 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.01 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|