C18H24FN3O — CID 137203681
1-[(5R)-5-[(1E,3Z,5E)-6-fluorohepta-1,3,5-trienyl]-2,7,7-trimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]ethanone (PubChem CID 137203681) has the molecular formula C18H24FN3O and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-[(5R)-5-[(1E,3Z,5E)-6-fluorohepta-1,3,5-trienyl]-2,7,7-trimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]ethanone.
| Compound Name | 1-[(5R)-5-[(1E,3Z,5E)-6-fluorohepta-1,3,5-trienyl]-2,7,7-trimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]ethanone |
|---|---|
| PubChem CID | 137203681 |
| Molecular Formula | C18H24FN3O |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 1-[(5R)-5-[(1E,3Z,5E)-6-fluorohepta-1,3,5-trienyl]-2,7,7-trimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidin-3-yl]ethanone |
| SMILES | CC(=O)c1c(C)nn2c1N[C@@H](/C=C/C=C\C=C(/C)F)CC2(C)C |
| InChI | InChI=1S/C18H24FN3O/c1-12(19)9-7-6-8-10-15-11-18(4,5)22-17(20-15)16(14(3)23)13(2)21-22/h6-10,15,20H,11H2,1-5H3/b7-6-,10-8+,12-9+/t15-/m0/s1 |
| InChIKey | RVDHLKKUVXXLKY-ORJPXNKSSA-N |
| XLogP | 4.30 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|