C19H17N3O4S2 — CID 137216324
4-[[[(5E)-5-(2,3-dihydro-1-benzofuran-5-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]methyl]benzenesulfonamide (PubChem CID 137216324) has the molecular formula C19H17N3O4S2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 4-[[[(5E)-5-(2,3-dihydro-1-benzofuran-5-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[[(5E)-5-(2,3-dihydro-1-benzofuran-5-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 137216324 |
| Molecular Formula | C19H17N3O4S2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 4-[[[(5E)-5-(2,3-dihydro-1-benzofuran-5-ylmethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]amino]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C/N=C2/NC(=O)/C(=C\c3ccc4c(c3)CCO4)S2)cc1 |
| InChI | InChI=1S/C19H17N3O4S2/c20-28(24,25)15-4-1-12(2-5-15)11-21-19-22-18(23)17(27-19)10-13-3-6-16-14(9-13)7-8-26-16/h1-6,9-10H,7-8,11H2,(H2,20,24,25)(H,21,22,23)/b17-10+ |
| InChIKey | RIGCHTPIPGOSMZ-LICLKQGHSA-N |
| XLogP | 2.03 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|