C44H28N4OV — CID 137217001
3,5-diphenyl-2,7-di(phenyl)-21,23-dihydroporphyrin;oxovanadium(2+) (PubChem CID 137217001) has the molecular formula C44H28N4OV and a molecular weight of 679.68 g/mol. Its IUPAC name is 3,5-diphenyl-2,7-di(phenyl)-21,23-dihydroporphyrin;oxovanadium(2+).
| Compound Name | 3,5-diphenyl-2,7-di(phenyl)-21,23-dihydroporphyrin;oxovanadium(2+) |
|---|---|
| PubChem CID | 137217001 |
| Molecular Formula | C44H28N4OV |
| Molecular Weight | 679.68 g/mol |
| Exact Mass | 679.17 |
| IUPAC Name | 3,5-diphenyl-2,7-di(phenyl)-21,23-dihydroporphyrin;oxovanadium(2+) |
| SMILES | O=[V+2].[c-]1ccc(C2=Cc3cc4ccc(cc5nc(cc6[nH]c(c(-c7ccccc7)c2n3)c(-c2ccccc2)c6-c2cc[c-]cc2)C=C5)[nH]4)cc1 |
| InChI | InChI=1S/C44H28N4.O.V/c1-5-13-29(14-6-1)38-27-37-26-35-22-21-33(45-35)25-34-23-24-36(46-34)28-39-40(30-15-7-2-8-16-30)41(31-17-9-3-10-18-31)44(48-39)42(43(38)47-37)32-19-11-4-12-20-32;;/h3-28,45,48H;;/q-2;;+2/b33-25-,34-25-,35-26-,36-28-,37-26-,39-28+,43-42-,44-42+;; |
| InChIKey | MTANPAALBCUOIK-OUVNUWQXSA-N |
| XLogP | 10.55 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.68 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|