C47H32N4O2 — CID 154636881
(3,5,7,21-tetraphenyl-23H-porphyrin-2-yl) prop-2-enoate (PubChem CID 154636881) has the molecular formula C47H32N4O2 and a molecular weight of 684.80 g/mol. Its IUPAC name is (3,5,7,21-tetraphenyl-23H-porphyrin-2-yl) prop-2-enoate.
| Compound Name | (3,5,7,21-tetraphenyl-23H-porphyrin-2-yl) prop-2-enoate |
|---|---|
| PubChem CID | 154636881 |
| Molecular Formula | C47H32N4O2 |
| Molecular Weight | 684.80 g/mol |
| Exact Mass | 684.25 |
| IUPAC Name | (3,5,7,21-tetraphenyl-23H-porphyrin-2-yl) prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(-c2ccccc2)c2c(-c3ccccc3)c3nc(cc4ccc(cc5nc(cc1n2-c1ccccc1)C=C5)[nH]4)C=C3c1ccccc1 |
| InChI | InChI=1S/C47H32N4O2/c1-2-42(52)53-47-41-30-37-26-25-35(49-37)27-34-23-24-36(48-34)28-38-29-40(31-15-7-3-8-16-31)45(50-38)43(32-17-9-4-10-18-32)46(44(47)33-19-11-5-12-20-33)51(41)39-21-13-6-14-22-39/h2-30,48H,1H2/b34-27-,35-27-,36-28-,37-30-,38-28-,41-30-,45-43-,46-43- |
| InChIKey | XGQNBWQCSFATLN-SUONUOJWSA-N |
| XLogP | 10.96 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.80 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|