C24H23N3O5S — CID 137222006
2-[3-[[4-(3,4-dimethoxyphenyl)-5-methyl-6-oxo-1H-pyrimidin-2-yl]sulfanyl]propyl]isoindole-1,3-dione (PubChem CID 137222006) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is 2-[3-[[4-(3,4-dimethoxyphenyl)-5-methyl-6-oxo-1H-pyrimidin-2-yl]sulfanyl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[[4-(3,4-dimethoxyphenyl)-5-methyl-6-oxo-1H-pyrimidin-2-yl]sulfanyl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 137222006 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 2-[3-[[4-(3,4-dimethoxyphenyl)-5-methyl-6-oxo-1H-pyrimidin-2-yl]sulfanyl]propyl]isoindole-1,3-dione |
| SMILES | COc1ccc(-c2nc(SCCCN3C(=O)c4ccccc4C3=O)[nH]c(=O)c2C)cc1OC |
| InChI | InChI=1S/C24H23N3O5S/c1-14-20(15-9-10-18(31-2)19(13-15)32-3)25-24(26-21(14)28)33-12-6-11-27-22(29)16-7-4-5-8-17(16)23(27)30/h4-5,7-10,13H,6,11-12H2,1-3H3,(H,25,26,28) |
| InChIKey | NMSPRJXNSRNUDT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|