C8H6ClN3OS — CID 137224780
2-(5-amino-1,2,4-thiadiazol-3-yl)-5-chlorophenol (PubChem CID 137224780) has the molecular formula C8H6ClN3OS and a molecular weight of 227.68 g/mol. Its IUPAC name is 2-(5-amino-1,2,4-thiadiazol-3-yl)-5-chlorophenol.
| Compound Name | 2-(5-amino-1,2,4-thiadiazol-3-yl)-5-chlorophenol |
|---|---|
| PubChem CID | 137224780 |
| Molecular Formula | C8H6ClN3OS |
| Molecular Weight | 227.68 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 2-(5-amino-1,2,4-thiadiazol-3-yl)-5-chlorophenol |
| SMILES | Nc1nc(-c2ccc(Cl)cc2O)ns1 |
| InChI | InChI=1S/C8H6ClN3OS/c9-4-1-2-5(6(13)3-4)7-11-8(10)14-12-7/h1-3,13H,(H2,10,11,12) |
| InChIKey | AGGNLYFAJDAYIB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.68 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |