C37H45N4O3+ — CID 137230078
tert-butyl 2-[2-(6,20-diethyl-7,7,17,19,19-pentamethyl-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaen-13-yl)imidazol-1-yl]acetate (PubChem CID 137230078) has the molecular formula C37H45N4O3+ and a molecular weight of 593.79 g/mol. Its IUPAC name is tert-butyl 2-[2-(6,20-diethyl-7,7,17,19,19-pentamethyl-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaen-13-yl)imidazol-1-yl]acetate.
| Compound Name | tert-butyl 2-[2-(6,20-diethyl-7,7,17,19,19-pentamethyl-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaen-13-yl)imidazol-1-yl]acetate |
|---|---|
| PubChem CID | 137230078 |
| Molecular Formula | C37H45N4O3+ |
| Molecular Weight | 593.79 g/mol |
| Exact Mass | 593.35 |
| IUPAC Name | tert-butyl 2-[2-(6,20-diethyl-7,7,17,19,19-pentamethyl-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaen-13-yl)imidazol-1-yl]acetate |
| SMILES | CCN1c2cc3c(cc2C(C)=CC1(C)C)C(c1nccn1CC(=O)OC(C)(C)C)=c1cc2c(cc1O3)=[N+](CC)C(C)(C)C=C2 |
| InChI | InChI=1S/C37H45N4O3/c1-11-40-28-19-30-26(17-24(28)13-14-36(40,7)8)33(34-38-15-16-39(34)22-32(42)44-35(4,5)6)27-18-25-23(3)21-37(9,10)41(12-2)29(25)20-31(27)43-30/h13-21H,11-12,22H2,1-10H3/q+1 |
| InChIKey | XUGRIAKRDPXESB-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 59.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.79 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|