C34H40N4O — CID 58291564
6,20-diethyl-7,7,9,17,19,19-hexamethyl-13-(3-methylpyrazin-2-yl)-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5(10),8,11,14,16(21),17-octaene (PubChem CID 58291564) has the molecular formula C34H40N4O and a molecular weight of 520.72 g/mol. Its IUPAC name is 6,20-diethyl-7,7,9,17,19,19-hexamethyl-13-(3-methylpyrazin-2-yl)-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5(10),8,11,14,16(21),17-octaene.
| Compound Name | 6,20-diethyl-7,7,9,17,19,19-hexamethyl-13-(3-methylpyrazin-2-yl)-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5(10),8,11,14,16(21),17-octaene |
|---|---|
| PubChem CID | 58291564 |
| Molecular Formula | C34H40N4O |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | 6,20-diethyl-7,7,9,17,19,19-hexamethyl-13-(3-methylpyrazin-2-yl)-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3,5(10),8,11,14,16(21),17-octaene |
| SMILES | CCN1c2cc3c(cc2C(C)=CC1(C)C)C(c1nccnc1C)c1cc2c(cc1O3)N(CC)C(C)(C)C=C2C |
| InChI | InChI=1S/C34H40N4O/c1-10-37-27-16-29-25(14-23(27)20(3)18-33(37,6)7)31(32-22(5)35-12-13-36-32)26-15-24-21(4)19-34(8,9)38(11-2)28(24)17-30(26)39-29/h12-19,31H,10-11H2,1-9H3 |
| InChIKey | RCCLMZJIWSZNPW-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|