C28H33N2O+ — CID 18724050
20-ethyl-6,7,7,13,17,19,19-heptamethyl-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaene (PubChem CID 18724050) has the molecular formula C28H33N2O+ and a molecular weight of 413.59 g/mol. Its IUPAC name is 20-ethyl-6,7,7,13,17,19,19-heptamethyl-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaene.
| Compound Name | 20-ethyl-6,7,7,13,17,19,19-heptamethyl-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaene |
|---|---|
| PubChem CID | 18724050 |
| Molecular Formula | C28H33N2O+ |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | 20-ethyl-6,7,7,13,17,19,19-heptamethyl-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaene |
| SMILES | CCN1c2cc3c(cc2C(C)=CC1(C)C)C(C)=c1cc2c(cc1O3)=[N+](C)C(C)(C)C=C2 |
| InChI | InChI=1S/C28H33N2O/c1-9-30-24-15-26-22(13-20(24)17(2)16-28(30,6)7)18(3)21-12-19-10-11-27(4,5)29(8)23(19)14-25(21)31-26/h10-16H,9H2,1-8H3/q+1 |
| InChIKey | QTXVPIYGLJQMGL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|