C35H35Cl2N2O3+ — CID 169436353
4,5-dichloro-2-(6,20-diethyl-7,7,17,19,19-pentamethyl-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaen-13-yl)benzoic acid (PubChem CID 169436353) has the molecular formula C35H35Cl2N2O3+ and a molecular weight of 602.58 g/mol. Its IUPAC name is 4,5-dichloro-2-(6,20-diethyl-7,7,17,19,19-pentamethyl-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaen-13-yl)benzoic acid.
| Compound Name | 4,5-dichloro-2-(6,20-diethyl-7,7,17,19,19-pentamethyl-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaen-13-yl)benzoic acid |
|---|---|
| PubChem CID | 169436353 |
| Molecular Formula | C35H35Cl2N2O3+ |
| Molecular Weight | 602.58 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | 4,5-dichloro-2-(6,20-diethyl-7,7,17,19,19-pentamethyl-2-oxa-20-aza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,17,21-nonaen-13-yl)benzoic acid |
| SMILES | CCN1c2cc3c(cc2C(C)=CC1(C)C)C(c1cc(Cl)c(Cl)cc1C(=O)O)=c1cc2c(cc1O3)=[N+](CC)C(C)(C)C=C2 |
| InChI | InChI=1S/C35H34Cl2N2O3/c1-8-38-28-16-30-24(12-20(28)10-11-34(38,4)5)32(22-14-26(36)27(37)15-23(22)33(40)41)25-13-21-19(3)18-35(6,7)39(9-2)29(21)17-31(25)42-30/h10-18H,8-9H2,1-7H3/p+1 |
| InChIKey | PGQAERPIWZEJGT-UHFFFAOYSA-O |
| XLogP | 7.38 |
| TPSA | 52.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.58 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|