C31H37NO — CID 59941407
6,20-diethyl-7,7,9,13,19,19,22-heptamethyl-2-oxa-6-azapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3(12),4,8,10,13,15,17,20-nonaene (PubChem CID 59941407) has the molecular formula C31H37NO and a molecular weight of 439.64 g/mol. Its IUPAC name is 6,20-diethyl-7,7,9,13,19,19,22-heptamethyl-2-oxa-6-azapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3(12),4,8,10,13,15,17,20-nonaene.
| Compound Name | 6,20-diethyl-7,7,9,13,19,19,22-heptamethyl-2-oxa-6-azapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3(12),4,8,10,13,15,17,20-nonaene |
|---|---|
| PubChem CID | 59941407 |
| Molecular Formula | C31H37NO |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | 6,20-diethyl-7,7,9,13,19,19,22-heptamethyl-2-oxa-6-azapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),3(12),4,8,10,13,15,17,20-nonaene |
| SMILES | CCC1=c2c(cc3c(c2C)Oc2cc4c(cc2C=3C)C(C)=CC(C)(C)N4CC)C=CC1(C)C |
| InChI | InChI=1S/C31H37NO/c1-10-25-28-20(5)29-24(14-21(28)12-13-30(25,6)7)19(4)23-15-22-18(3)17-31(8,9)32(11-2)26(22)16-27(23)33-29/h12-17H,10-11H2,1-9H3 |
| InChIKey | GUFPRWMQHVZADO-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|