C23H24N4O2S — CID 137237081
(6S)-3-butylsulfanyl-6-(4-prop-2-enoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one (PubChem CID 137237081) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is (6S)-3-butylsulfanyl-6-(4-prop-2-enoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one.
| Compound Name | (6S)-3-butylsulfanyl-6-(4-prop-2-enoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
|---|---|
| PubChem CID | 137237081 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (6S)-3-butylsulfanyl-6-(4-prop-2-enoxyphenyl)-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-1-one |
| SMILES | C=CCOc1ccc([C@H]2N=c3ccccc3=C3C(=O)NC(SCCCC)=NN32)cc1 |
| InChI | InChI=1S/C23H24N4O2S/c1-3-5-15-30-23-25-22(28)20-18-8-6-7-9-19(18)24-21(27(20)26-23)16-10-12-17(13-11-16)29-14-4-2/h4,6-13,21H,2-3,5,14-15H2,1H3,(H,25,26,28)/t21-/m0/s1 |
| InChIKey | DVNYHUIVQSYCGD-NRFANRHFSA-N |
| XLogP | 2.93 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|