C27H28ClN6O10P2+ — CID 137247473
[[(3R,4S)-5-[2-amino-7-[(3-chloro-4-phenylphenyl)methyl]-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-pyrrol-1-ylphosphinic acid (PubChem CID 137247473) has the molecular formula C27H28ClN6O10P2+ and a molecular weight of 693.95 g/mol. Its IUPAC name is [[(3R,4S)-5-[2-amino-7-[(3-chloro-4-phenylphenyl)methyl]-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-pyrrol-1-ylphosphinic acid.
| Compound Name | [[(3R,4S)-5-[2-amino-7-[(3-chloro-4-phenylphenyl)methyl]-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-pyrrol-1-ylphosphinic acid |
|---|---|
| PubChem CID | 137247473 |
| Molecular Formula | C27H28ClN6O10P2+ |
| Molecular Weight | 693.95 g/mol |
| Exact Mass | 693.10 |
| IUPAC Name | [[(3R,4S)-5-[2-amino-7-[(3-chloro-4-phenylphenyl)methyl]-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-pyrrol-1-ylphosphinic acid |
| SMILES | Nc1nc2c(c(=O)[nH]1)n(Cc1ccc(-c3ccccc3)c(Cl)c1)c[n+]2C1OC(COP(=O)(O)OP(=O)(O)n2cccc2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H27ClN6O10P2/c28-19-12-16(8-9-18(19)17-6-2-1-3-7-17)13-32-15-34(24-21(32)25(37)31-27(29)30-24)26-23(36)22(35)20(43-26)14-42-46(40,41)44-45(38,39)33-10-4-5-11-33/h1-12,15,20,22-23,26,35-36H,13-14H2,(H4-,29,30,31,37,38,39,40,41)/p+1/t20?,22-,23-,26?/m0/s1 |
| InChIKey | ZIKCKCQBMVEAOF-BZYPPAADSA-O |
| XLogP | 2.17 |
| TPSA | 228.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.95 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|