C20H24N7O12P2+ — CID 137247456
[(2R,3S,4R,5R)-5-[2-amino-7-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 137247456) has the molecular formula C20H24N7O12P2+ and a molecular weight of 616.40 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[2-amino-7-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[2-amino-7-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 137247456 |
| Molecular Formula | C20H24N7O12P2+ |
| Molecular Weight | 616.40 g/mol |
| Exact Mass | 616.10 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[2-amino-7-[[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]methyl]-6-oxo-1H-purin-9-ium-9-yl]-3,4-dihydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | Cc1nc(-c2ccc(Cn3c[n+]([C@@H]4O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]4O)c4nc(N)[nH]c(=O)c43)cc2)no1 |
| InChI | InChI=1S/C20H23N7O12P2/c1-9-22-16(25-38-9)11-4-2-10(3-5-11)6-26-8-27(17-13(26)18(30)24-20(21)23-17)19-15(29)14(28)12(37-19)7-36-41(34,35)39-40(31,32)33/h2-5,8,12,14-15,19,28-29H,6-7H2,1H3,(H5-,21,23,24,30,31,32,33,34,35)/p+1/t12-,14-,15-,19-/m1/s1 |
| InChIKey | BTISIRFRSYMHDP-QEPJRFBGSA-O |
| XLogP | -1.15 |
| TPSA | 282.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.40 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|