C15H27N5O4 — CID 137257953
7-(2,3-dihydroxypropyl)-8-hexylimino-3-methyl-5,9-dihydro-4H-purine-2,6-dione (PubChem CID 137257953) has the molecular formula C15H27N5O4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 7-(2,3-dihydroxypropyl)-8-hexylimino-3-methyl-5,9-dihydro-4H-purine-2,6-dione.
| Compound Name | 7-(2,3-dihydroxypropyl)-8-hexylimino-3-methyl-5,9-dihydro-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 137257953 |
| Molecular Formula | C15H27N5O4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 7-(2,3-dihydroxypropyl)-8-hexylimino-3-methyl-5,9-dihydro-4H-purine-2,6-dione |
| SMILES | CCCCCC/N=C1\NC2C(C(=O)NC(=O)N2C)N1CC(O)CO |
| InChI | InChI=1S/C15H27N5O4/c1-3-4-5-6-7-16-14-17-12-11(20(14)8-10(22)9-21)13(23)18-15(24)19(12)2/h10-12,21-22H,3-9H2,1-2H3,(H,16,17)(H,18,23,24) |
| InChIKey | CHPNUXRKGNLZAF-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|