C9H10ClNO2 — CID 137265557
(1Z)-N,4-dihydroxy-3,5-dimethylbenzenecarboximidoyl chloride (PubChem CID 137265557) has the molecular formula C9H10ClNO2 and a molecular weight of 199.64 g/mol. Its IUPAC name is (1Z)-N,4-dihydroxy-3,5-dimethylbenzenecarboximidoyl chloride.
| Compound Name | (1Z)-N,4-dihydroxy-3,5-dimethylbenzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 137265557 |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | (1Z)-N,4-dihydroxy-3,5-dimethylbenzenecarboximidoyl chloride |
| SMILES | Cc1cc(/C(Cl)=N/O)cc(C)c1O |
| InChI | InChI=1S/C9H10ClNO2/c1-5-3-7(9(10)11-13)4-6(2)8(5)12/h3-4,12-13H,1-2H3/b11-9- |
| InChIKey | YSMZSOHLOYIELM-LUAWRHEFSA-N |
| XLogP | 2.38 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|