C17H13N3O — CID 137269434
2,4-dihydropyrazolo[4,3-b]indol-3-yl-(4-methylphenyl)methanone (PubChem CID 137269434) has the molecular formula C17H13N3O and a molecular weight of 275.31 g/mol. Its IUPAC name is 2,4-dihydropyrazolo[4,3-b]indol-3-yl-(4-methylphenyl)methanone.
| Compound Name | 2,4-dihydropyrazolo[4,3-b]indol-3-yl-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 137269434 |
| Molecular Formula | C17H13N3O |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2,4-dihydropyrazolo[4,3-b]indol-3-yl-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2[nH]nc3c2[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C17H13N3O/c1-10-6-8-11(9-7-10)17(21)16-15-14(19-20-16)12-4-2-3-5-13(12)18-15/h2-9,18H,1H3,(H,19,20) |
| InChIKey | GCXOVMFXLRONCY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |