C20H14N2O2S — CID 137269714
(2Z)-2-[(4-hydroxy-3-phenyl-2-sulfanylidene-1H-imidazol-5-yl)methylidene]naphthalen-1-one (PubChem CID 137269714) has the molecular formula C20H14N2O2S and a molecular weight of 346.41 g/mol. Its IUPAC name is (2Z)-2-[(4-hydroxy-3-phenyl-2-sulfanylidene-1H-imidazol-5-yl)methylidene]naphthalen-1-one.
| Compound Name | (2Z)-2-[(4-hydroxy-3-phenyl-2-sulfanylidene-1H-imidazol-5-yl)methylidene]naphthalen-1-one |
|---|---|
| PubChem CID | 137269714 |
| Molecular Formula | C20H14N2O2S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | (2Z)-2-[(4-hydroxy-3-phenyl-2-sulfanylidene-1H-imidazol-5-yl)methylidene]naphthalen-1-one |
| SMILES | O=C1/C(=C\c2[nH]c(=S)n(-c3ccccc3)c2O)C=Cc2ccccc21 |
| InChI | InChI=1S/C20H14N2O2S/c23-18-14(11-10-13-6-4-5-9-16(13)18)12-17-19(24)22(20(25)21-17)15-7-2-1-3-8-15/h1-12,24H,(H,21,25)/b14-12- |
| InChIKey | XEUDGOCNYQIGSR-OWBHPGMISA-N |
| XLogP | 4.53 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|