C14H22N4O2 — CID 137270065
4-heptan-2-ylimino-1,3-dimethyl-2,6-dioxo-1,3-diazinane-5-carbonitrile (PubChem CID 137270065) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-heptan-2-ylimino-1,3-dimethyl-2,6-dioxo-1,3-diazinane-5-carbonitrile.
| Compound Name | 4-heptan-2-ylimino-1,3-dimethyl-2,6-dioxo-1,3-diazinane-5-carbonitrile |
|---|---|
| PubChem CID | 137270065 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 4-heptan-2-ylimino-1,3-dimethyl-2,6-dioxo-1,3-diazinane-5-carbonitrile |
| SMILES | CCCCCC(C)/N=C1\C(C#N)C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C14H22N4O2/c1-5-6-7-8-10(2)16-12-11(9-15)13(19)18(4)14(20)17(12)3/h10-11H,5-8H2,1-4H3/b16-12+ |
| InChIKey | UGLPHFZLGOLZRX-FOWTUZBSSA-N |
| XLogP | 2.02 |
| TPSA | 76.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|