C22H22N4O2 — CID 137272903
N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-4-methyl-5-phenylpyrazolidine-3-carboxamide (PubChem CID 137272903) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-4-methyl-5-phenylpyrazolidine-3-carboxamide.
| Compound Name | N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-4-methyl-5-phenylpyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 137272903 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-4-methyl-5-phenylpyrazolidine-3-carboxamide |
| SMILES | CC1C(C(=O)N/N=C/c2c(O)ccc3ccccc23)NNC1c1ccccc1 |
| InChI | InChI=1S/C22H22N4O2/c1-14-20(16-8-3-2-4-9-16)24-25-21(14)22(28)26-23-13-18-17-10-6-5-7-15(17)11-12-19(18)27/h2-14,20-21,24-25,27H,1H3,(H,26,28)/b23-13+ |
| InChIKey | HXJZRZIJBFYOKZ-YDZHTSKRSA-N |
| XLogP | 2.85 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|