C7H8F3N3O — CID 137273196
4-(1,1,1-trifluoropropan-2-ylamino)-1H-pyrimidin-6-one (PubChem CID 137273196) has the molecular formula C7H8F3N3O and a molecular weight of 207.16 g/mol. Its IUPAC name is 4-(1,1,1-trifluoropropan-2-ylamino)-1H-pyrimidin-6-one.
| Compound Name | 4-(1,1,1-trifluoropropan-2-ylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137273196 |
| Molecular Formula | C7H8F3N3O |
| Molecular Weight | 207.16 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 4-(1,1,1-trifluoropropan-2-ylamino)-1H-pyrimidin-6-one |
| SMILES | CC(Nc1cc(=O)[nH]cn1)C(F)(F)F |
| InChI | InChI=1S/C7H8F3N3O/c1-4(7(8,9)10)13-5-2-6(14)12-3-11-5/h2-4H,1H3,(H2,11,12,13,14) |
| InChIKey | POEQXYLIVXZVHK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.16 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |