C17H12F3N3O2S2 — CID 137276892
4-hydroxy-5-[(2-methoxyphenyl)diazenyl]-3-[3-(trifluoromethyl)phenyl]-1,3-thiazole-2-thione (PubChem CID 137276892) has the molecular formula C17H12F3N3O2S2 and a molecular weight of 411.43 g/mol. Its IUPAC name is 4-hydroxy-5-[(2-methoxyphenyl)diazenyl]-3-[3-(trifluoromethyl)phenyl]-1,3-thiazole-2-thione.
| Compound Name | 4-hydroxy-5-[(2-methoxyphenyl)diazenyl]-3-[3-(trifluoromethyl)phenyl]-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 137276892 |
| Molecular Formula | C17H12F3N3O2S2 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 4-hydroxy-5-[(2-methoxyphenyl)diazenyl]-3-[3-(trifluoromethyl)phenyl]-1,3-thiazole-2-thione |
| SMILES | COc1ccccc1/N=N/c1sc(=S)n(-c2cccc(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C17H12F3N3O2S2/c1-25-13-8-3-2-7-12(13)21-22-14-15(24)23(16(26)27-14)11-6-4-5-10(9-11)17(18,19)20/h2-9,24H,1H3/b22-21+ |
| InChIKey | YAAZUFBKPVTQOQ-QURGRASLSA-N |
| XLogP | 6.42 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|