C20H15N3O3S — CID 137277299
4-(4-methoxyanilino)-5-[(E)-(2-oxoquinolin-3-ylidene)methyl]-3H-1,3-thiazol-2-one (PubChem CID 137277299) has the molecular formula C20H15N3O3S and a molecular weight of 377.43 g/mol. Its IUPAC name is 4-(4-methoxyanilino)-5-[(E)-(2-oxoquinolin-3-ylidene)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-(4-methoxyanilino)-5-[(E)-(2-oxoquinolin-3-ylidene)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 137277299 |
| Molecular Formula | C20H15N3O3S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 4-(4-methoxyanilino)-5-[(E)-(2-oxoquinolin-3-ylidene)methyl]-3H-1,3-thiazol-2-one |
| SMILES | COc1ccc(Nc2[nH]c(=O)sc2/C=C2\C=c3ccccc3=NC2=O)cc1 |
| InChI | InChI=1S/C20H15N3O3S/c1-26-15-8-6-14(7-9-15)21-18-17(27-20(25)23-18)11-13-10-12-4-2-3-5-16(12)22-19(13)24/h2-11,21H,1H3,(H,23,25)/b13-11+ |
| InChIKey | PLCTXHJWMRRBIM-ACCUITESSA-N |
| XLogP | 2.21 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|