C21H25N3O7 — CID 137283293
tert-butyl N-[3-(4-hydroxyphenyl)-1-oxo-1-[(2E)-2-[(2,3,4-trihydroxyphenyl)methylidene]hydrazinyl]propan-2-yl]carbamate (PubChem CID 137283293) has the molecular formula C21H25N3O7 and a molecular weight of 431.45 g/mol. Its IUPAC name is tert-butyl N-[3-(4-hydroxyphenyl)-1-oxo-1-[(2E)-2-[(2,3,4-trihydroxyphenyl)methylidene]hydrazinyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-(4-hydroxyphenyl)-1-oxo-1-[(2E)-2-[(2,3,4-trihydroxyphenyl)methylidene]hydrazinyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 137283293 |
| Molecular Formula | C21H25N3O7 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | tert-butyl N-[3-(4-hydroxyphenyl)-1-oxo-1-[(2E)-2-[(2,3,4-trihydroxyphenyl)methylidene]hydrazinyl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(O)cc1)C(=O)N/N=C/c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C21H25N3O7/c1-21(2,3)31-20(30)23-15(10-12-4-7-14(25)8-5-12)19(29)24-22-11-13-6-9-16(26)18(28)17(13)27/h4-9,11,15,25-28H,10H2,1-3H3,(H,23,30)(H,24,29)/b22-11+ |
| InChIKey | OJSISSYWHVKQCO-SSDVNMTOSA-N |
| XLogP | 2.10 |
| TPSA | 160.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|