C57H63N7S — CID 137283485
N-[6-amino-4,7-bis[4-(N-(4-tert-butylphenyl)anilino)phenyl]-1-heptan-3-ylbenzotriazol-5-yl]thiohydroxylamine (PubChem CID 137283485) has the molecular formula C57H63N7S and a molecular weight of 878.25 g/mol. Its IUPAC name is N-[6-amino-4,7-bis[4-(N-(4-tert-butylphenyl)anilino)phenyl]-1-heptan-3-ylbenzotriazol-5-yl]thiohydroxylamine.
| Compound Name | N-[6-amino-4,7-bis[4-(N-(4-tert-butylphenyl)anilino)phenyl]-1-heptan-3-ylbenzotriazol-5-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 137283485 |
| Molecular Formula | C57H63N7S |
| Molecular Weight | 878.25 g/mol |
| Exact Mass | 877.49 |
| IUPAC Name | N-[6-amino-4,7-bis[4-(N-(4-tert-butylphenyl)anilino)phenyl]-1-heptan-3-ylbenzotriazol-5-yl]thiohydroxylamine |
| SMILES | CCCCC(CC)n1nnc2c(-c3ccc(N(c4ccccc4)c4ccc(C(C)(C)C)cc4)cc3)c(NS)c(N)c(-c3ccc(N(c4ccccc4)c4ccc(C(C)(C)C)cc4)cc3)c21 |
| InChI | InChI=1S/C57H63N7S/c1-9-11-18-43(10-2)64-55-50(39-23-31-46(32-24-39)62(44-19-14-12-15-20-44)48-35-27-41(28-36-48)56(3,4)5)52(58)53(60-65)51(54(55)59-61-64)40-25-33-47(34-26-40)63(45-21-16-13-17-22-45)49-37-29-42(30-38-49)57(6,7)8/h12-17,19-38,43,60,65H,9-11,18,58H2,1-8H3 |
| InChIKey | KCOPGGXGKQBWLG-UHFFFAOYSA-N |
| XLogP | 16.28 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.25 |
| LogP ≤ 5 | 16.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|