C34H35FN4O3 — CID 137283505
N-[6-[4-[(8-benzyl-3-hydroxy-6-phenylimidazo[1,2-a]pyrazin-2-yl)methyl]-2-fluorophenoxy]hexyl]acetamide (PubChem CID 137283505) has the molecular formula C34H35FN4O3 and a molecular weight of 566.68 g/mol. Its IUPAC name is N-[6-[4-[(8-benzyl-3-hydroxy-6-phenylimidazo[1,2-a]pyrazin-2-yl)methyl]-2-fluorophenoxy]hexyl]acetamide.
| Compound Name | N-[6-[4-[(8-benzyl-3-hydroxy-6-phenylimidazo[1,2-a]pyrazin-2-yl)methyl]-2-fluorophenoxy]hexyl]acetamide |
|---|---|
| PubChem CID | 137283505 |
| Molecular Formula | C34H35FN4O3 |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | N-[6-[4-[(8-benzyl-3-hydroxy-6-phenylimidazo[1,2-a]pyrazin-2-yl)methyl]-2-fluorophenoxy]hexyl]acetamide |
| SMILES | CC(=O)NCCCCCCOc1ccc(Cc2nc3c(Cc4ccccc4)nc(-c4ccccc4)cn3c2O)cc1F |
| InChI | InChI=1S/C34H35FN4O3/c1-24(40)36-18-10-2-3-11-19-42-32-17-16-26(20-28(32)35)22-30-34(41)39-23-31(27-14-8-5-9-15-27)37-29(33(39)38-30)21-25-12-6-4-7-13-25/h4-9,12-17,20,23,41H,2-3,10-11,18-19,21-22H2,1H3,(H,36,40) |
| InChIKey | OPIFJQQOXAGYFQ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|