C40H47FN4O4 — CID 159196455
tert-butyl N-[8-[4-[[8-benzyl-3-hydroxy-6-(4-methylphenyl)imidazo[1,2-a]pyrazin-2-yl]methyl]-2-fluorophenoxy]octyl]carbamate (PubChem CID 159196455) has the molecular formula C40H47FN4O4 and a molecular weight of 666.84 g/mol. Its IUPAC name is tert-butyl N-[8-[4-[[8-benzyl-3-hydroxy-6-(4-methylphenyl)imidazo[1,2-a]pyrazin-2-yl]methyl]-2-fluorophenoxy]octyl]carbamate.
| Compound Name | tert-butyl N-[8-[4-[[8-benzyl-3-hydroxy-6-(4-methylphenyl)imidazo[1,2-a]pyrazin-2-yl]methyl]-2-fluorophenoxy]octyl]carbamate |
|---|---|
| PubChem CID | 159196455 |
| Molecular Formula | C40H47FN4O4 |
| Molecular Weight | 666.84 g/mol |
| Exact Mass | 666.36 |
| IUPAC Name | tert-butyl N-[8-[4-[[8-benzyl-3-hydroxy-6-(4-methylphenyl)imidazo[1,2-a]pyrazin-2-yl]methyl]-2-fluorophenoxy]octyl]carbamate |
| SMILES | Cc1ccc(-c2cn3c(O)c(Cc4ccc(OCCCCCCCCNC(=O)OC(C)(C)C)c(F)c4)nc3c(Cc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C40H47FN4O4/c1-28-16-19-31(20-17-28)35-27-45-37(33(43-35)25-29-14-10-9-11-15-29)44-34(38(45)46)26-30-18-21-36(32(41)24-30)48-23-13-8-6-5-7-12-22-42-39(47)49-40(2,3)4/h9-11,14-21,24,27,46H,5-8,12-13,22-23,25-26H2,1-4H3,(H,42,47) |
| InChIKey | UVTUXMKEHCKRIF-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.84 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|